C16H15ClFNO3 — CID 129466775
(2S)-2-[[(1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]-2-(4-chloro-3-fluorophenyl)acetic acid (PubChem CID 129466775) has the molecular formula C16H15ClFNO3 and a molecular weight of 323.75 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]-2-(4-chloro-3-fluorophenyl)acetic acid.
| Compound Name | (2S)-2-[[(1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]-2-(4-chloro-3-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 129466775 |
| Molecular Formula | C16H15ClFNO3 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (2S)-2-[[(1R,2S,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]amino]-2-(4-chloro-3-fluorophenyl)acetic acid |
| SMILES | O=C(O)[C@@H](NC(=O)[C@H]1C[C@H]2C=C[C@H]1C2)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H15ClFNO3/c17-12-4-3-10(7-13(12)18)14(16(21)22)19-15(20)11-6-8-1-2-9(11)5-8/h1-4,7-9,11,14H,5-6H2,(H,19,20)(H,21,22)/t8-,9-,11-,14-/m0/s1 |
| InChIKey | BPQAZZQKTIWRCO-KJWJVKQFSA-N |
| XLogP | 2.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|