C15H23N3O5 — CID 129467724
4-[[2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-methylpentanoic acid (PubChem CID 129467724) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[[2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 129467724 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4-[[2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CN1C(=O)N[C@](C)(C2CC2)C1=O |
| InChI | InChI=1S/C15H23N3O5/c1-14(2,7-6-11(20)21)16-10(19)8-18-12(22)15(3,9-4-5-9)17-13(18)23/h9H,4-8H2,1-3H3,(H,16,19)(H,17,23)(H,20,21)/t15-/m1/s1 |
| InChIKey | CHJYGSSJYBAAID-OAHLLOKOSA-N |
| XLogP | 0.47 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|