C16H20N2O4 — CID 129468204
(3R,3aR,6aR)-2-(2-methoxy-6-methylpyridine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 129468204) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3R,3aR,6aR)-2-(2-methoxy-6-methylpyridine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3R,3aR,6aR)-2-(2-methoxy-6-methylpyridine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 129468204 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (3R,3aR,6aR)-2-(2-methoxy-6-methylpyridine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | COc1nc(C)ccc1C(=O)N1C[C@@H]2CCC[C@H]2[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-9-6-7-12(14(17-9)22-2)15(19)18-8-10-4-3-5-11(10)13(18)16(20)21/h6-7,10-11,13H,3-5,8H2,1-2H3,(H,20,21)/t10-,11+,13+/m0/s1 |
| InChIKey | DPNRHCYPCMDMTL-DMDPSCGWSA-N |
| XLogP | 1.72 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |