C15H18ClNO5 — CID 129468435
(2R)-4-[(2S)-2-(2-chloro-5-methylphenoxy)propanoyl]morpholine-2-carboxylic acid (PubChem CID 129468435) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is (2R)-4-[(2S)-2-(2-chloro-5-methylphenoxy)propanoyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[(2S)-2-(2-chloro-5-methylphenoxy)propanoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 129468435 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2R)-4-[(2S)-2-(2-chloro-5-methylphenoxy)propanoyl]morpholine-2-carboxylic acid |
| SMILES | Cc1ccc(Cl)c(O[C@@H](C)C(=O)N2CCO[C@@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C15H18ClNO5/c1-9-3-4-11(16)12(7-9)22-10(2)14(18)17-5-6-21-13(8-17)15(19)20/h3-4,7,10,13H,5-6,8H2,1-2H3,(H,19,20)/t10-,13+/m0/s1 |
| InChIKey | CCVIISFCMAYLIZ-GXFFZTMASA-N |
| XLogP | 1.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |