C19H22N2O4 — CID 129468538
(3R)-3-(methoxymethyl)-1-(2-methylquinoline-8-carbonyl)piperidine-3-carboxylic acid (PubChem CID 129468538) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3R)-3-(methoxymethyl)-1-(2-methylquinoline-8-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(methoxymethyl)-1-(2-methylquinoline-8-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129468538 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3R)-3-(methoxymethyl)-1-(2-methylquinoline-8-carbonyl)piperidine-3-carboxylic acid |
| SMILES | COC[C@@]1(C(=O)O)CCCN(C(=O)c2cccc3ccc(C)nc23)C1 |
| InChI | InChI=1S/C19H22N2O4/c1-13-7-8-14-5-3-6-15(16(14)20-13)17(22)21-10-4-9-19(11-21,12-25-2)18(23)24/h3,5-8H,4,9-12H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | OOVNEGYZAMFEDT-LJQANCHMSA-N |
| XLogP | 2.50 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |