C13H15ClN2O5S — CID 129468802
(3R)-1-[(4-chloro-3-methylsulfonylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 129468802) has the molecular formula C13H15ClN2O5S and a molecular weight of 346.79 g/mol. Its IUPAC name is (3R)-1-[(4-chloro-3-methylsulfonylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(4-chloro-3-methylsulfonylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129468802 |
| Molecular Formula | C13H15ClN2O5S |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (3R)-1-[(4-chloro-3-methylsulfonylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)N2CC[C@@H](C(=O)O)C2)ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O5S/c1-22(20,21)11-6-9(2-3-10(11)14)15-13(19)16-5-4-8(7-16)12(17)18/h2-3,6,8H,4-5,7H2,1H3,(H,15,19)(H,17,18)/t8-/m1/s1 |
| InChIKey | CLRAJPZTIJVHNT-MRVPVSSYSA-N |
| XLogP | 1.68 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |