C14H21NO4 — CID 129468979
(3R,3aR,6aR)-2-[(1S,2R)-2-ethoxycyclopropanecarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 129468979) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (3R,3aR,6aR)-2-[(1S,2R)-2-ethoxycyclopropanecarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3R,3aR,6aR)-2-[(1S,2R)-2-ethoxycyclopropanecarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 129468979 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (3R,3aR,6aR)-2-[(1S,2R)-2-ethoxycyclopropanecarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CCO[C@@H]1C[C@@H]1C(=O)N1C[C@@H]2CCC[C@H]2[C@@H]1C(=O)O |
| InChI | InChI=1S/C14H21NO4/c1-2-19-11-6-10(11)13(16)15-7-8-4-3-5-9(8)12(15)14(17)18/h8-12H,2-7H2,1H3,(H,17,18)/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | PNUMFVOAYTVFLU-RNWYCLNJSA-N |
| XLogP | 1.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |