C18H22N4O3 — CID 129470085
(3R)-3-methyl-1-[2-(5-methyl-1-phenyltriazol-4-yl)acetyl]piperidine-3-carboxylic acid (PubChem CID 129470085) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3R)-3-methyl-1-[2-(5-methyl-1-phenyltriazol-4-yl)acetyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-methyl-1-[2-(5-methyl-1-phenyltriazol-4-yl)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129470085 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3R)-3-methyl-1-[2-(5-methyl-1-phenyltriazol-4-yl)acetyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(CC(=O)N2CCC[C@@](C)(C(=O)O)C2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C18H22N4O3/c1-13-15(19-20-22(13)14-7-4-3-5-8-14)11-16(23)21-10-6-9-18(2,12-21)17(24)25/h3-5,7-8H,6,9-12H2,1-2H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | WOWARWHIOKSFTC-GOSISDBHSA-N |
| XLogP | 1.83 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |