About (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid
(2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid (PubChem CID 129470140) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid.
Molecular Properties
| Compound Name | (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid |
| PubChem CID | 129470140 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid |
| SMILES | CC(C)[C@@H](N[C@@H]1CC[C@](C)(c2ccccc2)C1)C(=O)O |
| InChI | InChI=1S/C17H25NO2/c1-12(2)15(16(19)20)18-14-9-10-17(3,11-14)13-7-5-4-6-8-13/h4-8,12,14-15,18H,9-11H2,1-3H3,(H,19,20)/t14-,15-,17+/m1/s1 |
| InChIKey | UKCXIESYQGVWJL-INMHGKMJSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid?
The IUPAC name of (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid (CID 129470140) is (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid.
What is the SMILES notation for (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid?
The canonical SMILES for (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid is CC(C)[C@@H](N[C@@H]1CC[C@](C)(c2ccccc2)C1)C(=O)O.
What is the InChIKey of (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid?
The InChIKey is UKCXIESYQGVWJL-INMHGKMJSA-N. The full InChI is InChI=1S/C17H25NO2/c1-12(2)15(16(19)20)18-14-9-10-17(3,11-14)13-7-5-4-6-8-13/h4-8,12,14-15,18H,9-11H2,1-3H3,(H,19,20)/t14-,15-,17+/m1/s1.
What are the key properties of (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid?
(2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid has a molecular weight of 275.39 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-2-[[(1R,3S)-3-methyl-3-phenylcyclopentyl]amino]butanoic acid is sourced from PubChem (CID 129470140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).