About 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione
5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 12947027) has the molecular formula C16H11F3N2S
and a molecular weight of 320.34 g/mol. Its IUPAC name is 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione.
Molecular Properties
| Compound Name | 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
| PubChem CID | 12947027 |
| Molecular Formula | C16H11F3N2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | FC(F)(F)c1ccc2c(c1)C(c1ccccc1)=NCC(=S)N2 |
| InChI | InChI=1S/C16H11F3N2S/c17-16(18,19)11-6-7-13-12(8-11)15(20-9-14(22)21-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22) |
| InChIKey | GKRGEAUFXFXNDI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The IUPAC name of 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione (CID 12947027) is 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione.
What is the SMILES notation for 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The canonical SMILES for 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione is FC(F)(F)c1ccc2c(c1)C(c1ccccc1)=NCC(=S)N2.
What is the InChIKey of 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The InChIKey is GKRGEAUFXFXNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3N2S/c17-16(18,19)11-6-7-13-12(8-11)15(20-9-14(22)21-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22).
What are the key properties of 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione has a molecular weight of 320.34 g/mol, XLogP of 4.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione is sourced from PubChem (CID 12947027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).