C33H43Cl2N3O4S — CID 12947040
(E)-but-2-enedioic acid;N-[2-[[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]sulfanyl]ethyl]-N-hexylhexan-1-amine (PubChem CID 12947040) has the molecular formula C33H43Cl2N3O4S and a molecular weight of 648.70 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[2-[[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]sulfanyl]ethyl]-N-hexylhexan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[2-[[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]sulfanyl]ethyl]-N-hexylhexan-1-amine |
|---|---|
| PubChem CID | 12947040 |
| Molecular Formula | C33H43Cl2N3O4S |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[2-[[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]sulfanyl]ethyl]-N-hexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)CCSC1=Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C29H39Cl2N3S.C4H4O4/c1-3-5-7-11-17-34(18-12-8-6-4-2)19-20-35-28-22-32-29(24-13-9-10-14-26(24)31)25-21-23(30)15-16-27(25)33-28;5-3(6)1-2-4(7)8/h9-10,13-16,21H,3-8,11-12,17-20,22H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RKNXIROUJVBYEU-WLHGVMLRSA-N |
| XLogP | 8.78 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|