C17H25FN2O2 — CID 129471572
1-[2-(2-fluorophenyl)ethyl]-3-[2-[(2R,4S)-2-methyloxan-4-yl]ethyl]urea (PubChem CID 129471572) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-3-[2-[(2R,4S)-2-methyloxan-4-yl]ethyl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-3-[2-[(2R,4S)-2-methyloxan-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 129471572 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-3-[2-[(2R,4S)-2-methyloxan-4-yl]ethyl]urea |
| SMILES | C[C@@H]1C[C@@H](CCNC(=O)NCCc2ccccc2F)CCO1 |
| InChI | InChI=1S/C17H25FN2O2/c1-13-12-14(8-11-22-13)6-9-19-17(21)20-10-7-15-4-2-3-5-16(15)18/h2-5,13-14H,6-12H2,1H3,(H2,19,20,21)/t13-,14+/m1/s1 |
| InChIKey | JRTRISKLSSEPES-KGLIPLIRSA-N |
| XLogP | 2.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |