C16H20N6OS2 — CID 1294727
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate (PubChem CID 1294727) has the molecular formula C16H20N6OS2 and a molecular weight of 376.51 g/mol. Its IUPAC name is [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate.
| Compound Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 1294727 |
| Molecular Formula | C16H20N6OS2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl morpholine-4-carbodithioate |
| SMILES | Cc1ccc(Nc2nc(N)nc(CSC(=S)N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H20N6OS2/c1-11-2-4-12(5-3-11)18-15-20-13(19-14(17)21-15)10-25-16(24)22-6-8-23-9-7-22/h2-5H,6-10H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | RAQZMPPWMZKMIJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|