C18H23N5O4 — CID 129473237
(5S)-5-[[(2-ethoxy-5-nitrophenyl)methylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 129473237) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (5S)-5-[[(2-ethoxy-5-nitrophenyl)methylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | (5S)-5-[[(2-ethoxy-5-nitrophenyl)methylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129473237 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (5S)-5-[[(2-ethoxy-5-nitrophenyl)methylamino]methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1CNC[C@H]1CCn2ncc(C(N)=O)c2C1 |
| InChI | InChI=1S/C18H23N5O4/c1-2-27-17-4-3-14(23(25)26)8-13(17)10-20-9-12-5-6-22-16(7-12)15(11-21-22)18(19)24/h3-4,8,11-12,20H,2,5-7,9-10H2,1H3,(H2,19,24)/t12-/m0/s1 |
| InChIKey | FEXPDQRLVQXXQZ-LBPRGKRZSA-N |
| XLogP | 1.64 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|