About 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one
3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 129475497) has the molecular formula C19H24N4O
and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one |
| PubChem CID | 129475497 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC[C@H](NC3Cc4ccccc4C3)C2)c1=O |
| InChI | InChI=1S/C19H24N4O/c1-22-10-8-20-18(19(22)24)23-9-4-7-16(13-23)21-17-11-14-5-2-3-6-15(14)12-17/h2-3,5-6,8,10,16-17,21H,4,7,9,11-13H2,1H3/t16-/m0/s1 |
| InChIKey | UAOVLXPZBQLNHT-INIZCTEOSA-N |
| XLogP | 1.51 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one?
The IUPAC name of 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one (CID 129475497) is 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one.
What is the SMILES notation for 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one?
The canonical SMILES for 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one is Cn1ccnc(N2CCC[C@H](NC3Cc4ccccc4C3)C2)c1=O.
What is the InChIKey of 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one?
The InChIKey is UAOVLXPZBQLNHT-INIZCTEOSA-N. The full InChI is InChI=1S/C19H24N4O/c1-22-10-8-20-18(19(22)24)23-9-4-7-16(13-23)21-17-11-14-5-2-3-6-15(14)12-17/h2-3,5-6,8,10,16-17,21H,4,7,9,11-13H2,1H3/t16-/m0/s1.
What are the key properties of 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one?
3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one has a molecular weight of 324.43 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-3-(2,3-dihydro-1H-inden-2-ylamino)piperidin-1-yl]-1-methylpyrazin-2-one is sourced from PubChem (CID 129475497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).