C15H20N6O2S — CID 129476266
4-ethyl-N-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]thiadiazole-5-carboxamide (PubChem CID 129476266) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-ethyl-N-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 129476266 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-ethyl-N-[(3S)-1-(4-methyl-3-oxopyrazin-2-yl)piperidin-3-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)N[C@H]1CCCN(c2nccn(C)c2=O)C1 |
| InChI | InChI=1S/C15H20N6O2S/c1-3-11-12(24-19-18-11)14(22)17-10-5-4-7-21(9-10)13-15(23)20(2)8-6-16-13/h6,8,10H,3-5,7,9H2,1-2H3,(H,17,22)/t10-/m0/s1 |
| InChIKey | ORXSPKKSSQZJBD-JTQLQIEISA-N |
| XLogP | 0.59 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |