About [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene
[(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene (PubChem CID 12947660) has the molecular formula C9H7ClF2S
and a molecular weight of 220.67 g/mol. Its IUPAC name is [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene.
Molecular Properties
| Compound Name | [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene |
| PubChem CID | 12947660 |
| Molecular Formula | C9H7ClF2S |
| Molecular Weight | 220.67 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene |
| SMILES | F/C(Cl)=C(/F)SCc1ccccc1 |
| InChI | InChI=1S/C9H7ClF2S/c10-8(11)9(12)13-6-7-4-2-1-3-5-7/h1-5H,6H2/b9-8- |
| InChIKey | KIMAVEYDNGGSMB-HJWRWDBZSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene?
The IUPAC name of [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene (CID 12947660) is [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene.
What is the SMILES notation for [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene?
The canonical SMILES for [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene is F/C(Cl)=C(/F)SCc1ccccc1.
What is the InChIKey of [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene?
The InChIKey is KIMAVEYDNGGSMB-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H7ClF2S/c10-8(11)9(12)13-6-7-4-2-1-3-5-7/h1-5H,6H2/b9-8-.
What are the key properties of [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene?
[(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene has a molecular weight of 220.67 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-chloro-1,2-difluoroethenyl]sulfanylmethylbenzene is sourced from PubChem (CID 12947660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).