C15H22N4O4 — CID 129477899
2-[methyl-[[(2R)-4-(2-pyridin-3-yloxyacetyl)morpholin-2-yl]methyl]amino]acetamide (PubChem CID 129477899) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[methyl-[[(2R)-4-(2-pyridin-3-yloxyacetyl)morpholin-2-yl]methyl]amino]acetamide.
| Compound Name | 2-[methyl-[[(2R)-4-(2-pyridin-3-yloxyacetyl)morpholin-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 129477899 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[methyl-[[(2R)-4-(2-pyridin-3-yloxyacetyl)morpholin-2-yl]methyl]amino]acetamide |
| SMILES | CN(CC(N)=O)C[C@@H]1CN(C(=O)COc2cccnc2)CCO1 |
| InChI | InChI=1S/C15H22N4O4/c1-18(10-14(16)20)8-13-9-19(5-6-22-13)15(21)11-23-12-3-2-4-17-7-12/h2-4,7,13H,5-6,8-11H2,1H3,(H2,16,20)/t13-/m1/s1 |
| InChIKey | ATNRCRLHFYOHMS-CYBMUJFWSA-N |
| XLogP | -0.90 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |