C22H31N5O2 — CID 129477948
1-[(3S)-3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-4-(3,4-dimethylphenoxy)butan-1-one (PubChem CID 129477948) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[(3S)-3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-4-(3,4-dimethylphenoxy)butan-1-one.
| Compound Name | 1-[(3S)-3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-4-(3,4-dimethylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 129477948 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[(3S)-3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-4-(3,4-dimethylphenoxy)butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CC[C@H](N(C)Cc3nccc(N)n3)C2)cc1C |
| InChI | InChI=1S/C22H31N5O2/c1-16-6-7-19(13-17(16)2)29-12-4-5-22(28)27-11-9-18(14-27)26(3)15-21-24-10-8-20(23)25-21/h6-8,10,13,18H,4-5,9,11-12,14-15H2,1-3H3,(H2,23,24,25)/t18-/m0/s1 |
| InChIKey | CIBKQNUWCOGDBP-SFHVURJKSA-N |
| XLogP | 2.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|