About 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide
6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide (PubChem CID 12947851) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide.
Molecular Properties
| Compound Name | 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide |
| PubChem CID | 12947851 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide |
| SMILES | CCC1CCCC=C1C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H27NO/c1-6-13-9-7-8-10-14(13)15(17)16(11(2)3)12(4)5/h10-13H,6-9H2,1-5H3 |
| InChIKey | FBMGWYWSPAKUDP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide?
The IUPAC name of 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide (CID 12947851) is 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide.
What is the SMILES notation for 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide?
The canonical SMILES for 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide is CCC1CCCC=C1C(=O)N(C(C)C)C(C)C.
What is the InChIKey of 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide?
The InChIKey is FBMGWYWSPAKUDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-6-13-9-7-8-10-14(13)15(17)16(11(2)3)12(4)5/h10-13H,6-9H2,1-5H3.
What are the key properties of 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide?
6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide has a molecular weight of 237.39 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N,N-di(propan-2-yl)cyclohexene-1-carboxamide is sourced from PubChem (CID 12947851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).