C14H20N2O3 — CID 129479124
(2R,3R)-2-ethyl-N-(4-methoxy-3-pyridinyl)oxane-3-carboxamide (PubChem CID 129479124) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-N-(4-methoxy-3-pyridinyl)oxane-3-carboxamide.
| Compound Name | (2R,3R)-2-ethyl-N-(4-methoxy-3-pyridinyl)oxane-3-carboxamide |
|---|---|
| PubChem CID | 129479124 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R,3R)-2-ethyl-N-(4-methoxy-3-pyridinyl)oxane-3-carboxamide |
| SMILES | CC[C@H]1OCCC[C@H]1C(=O)Nc1cnccc1OC |
| InChI | InChI=1S/C14H20N2O3/c1-3-12-10(5-4-8-19-12)14(17)16-11-9-15-7-6-13(11)18-2/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,16,17)/t10-,12-/m1/s1 |
| InChIKey | GSPPVVQVZUZSQK-ZYHUDNBSSA-N |
| XLogP | 2.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |