C15H22N2O4S — CID 129479570
(2S,3S)-2-methyl-N-[(3-methyl-4-sulfamoylphenyl)methyl]oxane-3-carboxamide (PubChem CID 129479570) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S,3S)-2-methyl-N-[(3-methyl-4-sulfamoylphenyl)methyl]oxane-3-carboxamide.
| Compound Name | (2S,3S)-2-methyl-N-[(3-methyl-4-sulfamoylphenyl)methyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 129479570 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2S,3S)-2-methyl-N-[(3-methyl-4-sulfamoylphenyl)methyl]oxane-3-carboxamide |
| SMILES | Cc1cc(CNC(=O)[C@H]2CCCO[C@H]2C)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C15H22N2O4S/c1-10-8-12(5-6-14(10)22(16,19)20)9-17-15(18)13-4-3-7-21-11(13)2/h5-6,8,11,13H,3-4,7,9H2,1-2H3,(H,17,18)(H2,16,19,20)/t11-,13-/m0/s1 |
| InChIKey | MYCVZWQNRVFONV-AAEUAGOBSA-N |
| XLogP | 1.07 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |