C13H15N5O2S2 — CID 129479969
2-[(7-ethyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl)sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide (PubChem CID 129479969) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-[(7-ethyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl)sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide.
| Compound Name | 2-[(7-ethyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl)sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 129479969 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(7-ethyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl)sulfanyl]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
| SMILES | CCc1cc2nncn2c(SCC(=O)N[C@@H]2CCSC2=O)n1 |
| InChI | InChI=1S/C13H15N5O2S2/c1-2-8-5-10-17-14-7-18(10)13(15-8)22-6-11(19)16-9-3-4-21-12(9)20/h5,7,9H,2-4,6H2,1H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | IFPPJQONBQOIBA-SECBINFHSA-N |
| XLogP | 0.93 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|