C18H26N2O2 — CID 129480393
4-[[(2R)-2-[(1R,2R)-2-hydroxycyclohexyl]pyrrolidin-1-yl]methyl]benzamide (PubChem CID 129480393) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[[(2R)-2-[(1R,2R)-2-hydroxycyclohexyl]pyrrolidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[(2R)-2-[(1R,2R)-2-hydroxycyclohexyl]pyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 129480393 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 4-[[(2R)-2-[(1R,2R)-2-hydroxycyclohexyl]pyrrolidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CCC[C@@H]2[C@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C18H26N2O2/c19-18(22)14-9-7-13(8-10-14)12-20-11-3-5-16(20)15-4-1-2-6-17(15)21/h7-10,15-17,21H,1-6,11-12H2,(H2,19,22)/t15-,16-,17-/m1/s1 |
| InChIKey | LBIUYGLLSGPKIQ-BRWVUGGUSA-N |
| XLogP | 2.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |