C15H23NO3 — CID 129481356
(3R,5S)-1-(2-ethoxyethyl)-5-(3-methoxyphenyl)pyrrolidin-3-ol (PubChem CID 129481356) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (3R,5S)-1-(2-ethoxyethyl)-5-(3-methoxyphenyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-1-(2-ethoxyethyl)-5-(3-methoxyphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129481356 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (3R,5S)-1-(2-ethoxyethyl)-5-(3-methoxyphenyl)pyrrolidin-3-ol |
| SMILES | CCOCCN1C[C@H](O)C[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C15H23NO3/c1-3-19-8-7-16-11-13(17)10-15(16)12-5-4-6-14(9-12)18-2/h4-6,9,13,15,17H,3,7-8,10-11H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | YVKDDKHNXUCOGC-HIFRSBDPSA-N |
| XLogP | 1.84 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|