About phenanthro[9,10-c][1,2,5]thiadiazole
phenanthro[9,10-c][1,2,5]thiadiazole (PubChem CID 12948166) has the molecular formula C14H8N2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is phenanthro[9,10-c][1,2,5]thiadiazole.
Molecular Properties
| Compound Name | phenanthro[9,10-c][1,2,5]thiadiazole |
| PubChem CID | 12948166 |
| Molecular Formula | C14H8N2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | phenanthro[9,10-c][1,2,5]thiadiazole |
| SMILES | c1ccc2c(c1)c1ccccc1c1nsnc21 |
| InChI | InChI=1S/C14H8N2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-17-16-14/h1-8H |
| InChIKey | LOSAIEJZRUIALB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthro[9,10-c][1,2,5]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthro[9,10-c][1,2,5]thiadiazole?
The IUPAC name of phenanthro[9,10-c][1,2,5]thiadiazole (CID 12948166) is phenanthro[9,10-c][1,2,5]thiadiazole.
What is the SMILES notation for phenanthro[9,10-c][1,2,5]thiadiazole?
The canonical SMILES for phenanthro[9,10-c][1,2,5]thiadiazole is c1ccc2c(c1)c1ccccc1c1nsnc21.
What is the InChIKey of phenanthro[9,10-c][1,2,5]thiadiazole?
The InChIKey is LOSAIEJZRUIALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-17-16-14/h1-8H.
What are the key properties of phenanthro[9,10-c][1,2,5]thiadiazole?
phenanthro[9,10-c][1,2,5]thiadiazole has a molecular weight of 236.30 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthro[9,10-c][1,2,5]thiadiazole is sourced from PubChem (CID 12948166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).