C20H22N6O2 — CID 129482090
1-[5-(6-methoxy-3-pyridinyl)-2-methylphenyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea (PubChem CID 129482090) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[5-(6-methoxy-3-pyridinyl)-2-methylphenyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea.
| Compound Name | 1-[5-(6-methoxy-3-pyridinyl)-2-methylphenyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 129482090 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[5-(6-methoxy-3-pyridinyl)-2-methylphenyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
| SMILES | COc1ccc(-c2ccc(C)c(NC(=O)N[C@@H]3CCc4ncnn4C3)c2)cn1 |
| InChI | InChI=1S/C20H22N6O2/c1-13-3-4-14(15-5-8-19(28-2)21-10-15)9-17(13)25-20(27)24-16-6-7-18-22-12-23-26(18)11-16/h3-5,8-10,12,16H,6-7,11H2,1-2H3,(H2,24,25,27)/t16-/m1/s1 |
| InChIKey | SAWXKPXPKMIALD-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |