C24H20Cl2N3P3 — CID 12948224
2,2-dichloro-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 12948224) has the molecular formula C24H20Cl2N3P3 and a molecular weight of 514.27 g/mol. Its IUPAC name is 2,2-dichloro-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2-dichloro-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 12948224 |
| Molecular Formula | C24H20Cl2N3P3 |
| Molecular Weight | 514.27 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 2,2-dichloro-4,4,6,6-tetraphenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | ClP1(Cl)=NP(c2ccccc2)(c2ccccc2)=NP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C24H20Cl2N3P3/c25-32(26)28-30(21-13-5-1-6-14-21,22-15-7-2-8-16-22)27-31(29-32,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | YAINMHBMFWZSEZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.27 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|