C20H26N4O2 — CID 129482338
(5R,6R)-5-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-6-(2-methylpyrazol-3-yl)piperidin-2-one (PubChem CID 129482338) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (5R,6R)-5-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-6-(2-methylpyrazol-3-yl)piperidin-2-one.
| Compound Name | (5R,6R)-5-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-6-(2-methylpyrazol-3-yl)piperidin-2-one |
|---|---|
| PubChem CID | 129482338 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (5R,6R)-5-[[(2R)-7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-6-(2-methylpyrazol-3-yl)piperidin-2-one |
| SMILES | COc1ccc2c(c1)C[C@H](N[C@@H]1CCC(=O)N[C@H]1c1ccnn1C)CC2 |
| InChI | InChI=1S/C20H26N4O2/c1-24-18(9-10-21-24)20-17(7-8-19(25)23-20)22-15-5-3-13-4-6-16(26-2)12-14(13)11-15/h4,6,9-10,12,15,17,20,22H,3,5,7-8,11H2,1-2H3,(H,23,25)/t15-,17-,20-/m1/s1 |
| InChIKey | GQGOZRISNRXFTA-WRWLIDTKSA-N |
| XLogP | 1.90 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |