C14H20N4O2 — CID 129483951
2-(cyclohexen-1-yl)-1-[(3S)-3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]ethanone (PubChem CID 129483951) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[(3S)-3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[(3S)-3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 129483951 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[(3S)-3-hydroxy-3-(2H-triazol-4-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CC1=CCCCC1)N1CC[C@@](O)(c2cn[nH]n2)C1 |
| InChI | InChI=1S/C14H20N4O2/c19-13(8-11-4-2-1-3-5-11)18-7-6-14(20,10-18)12-9-15-17-16-12/h4,9,20H,1-3,5-8,10H2,(H,15,16,17)/t14-/m0/s1 |
| InChIKey | JVUYRDOXBZVZLP-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|