About [(E)-3-oxobut-1-enyl] carbamimidothioate
[(E)-3-oxobut-1-enyl] carbamimidothioate (PubChem CID 12948459) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is [(E)-3-oxobut-1-enyl] carbamimidothioate.
Molecular Properties
| Compound Name | [(E)-3-oxobut-1-enyl] carbamimidothioate |
| PubChem CID | 12948459 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | [(E)-3-oxobut-1-enyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)S/C=C/C(C)=O |
| InChI | InChI=1S/C5H8N2OS/c1-4(8)2-3-9-5(6)7/h2-3H,1H3,(H3,6,7)/b3-2+ |
| InChIKey | ZRMLNPOEKZQZQH-NSCUHMNNSA-N |
| XLogP | 0.72 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-oxobut-1-enyl] carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-oxobut-1-enyl] carbamimidothioate?
The IUPAC name of [(E)-3-oxobut-1-enyl] carbamimidothioate (CID 12948459) is [(E)-3-oxobut-1-enyl] carbamimidothioate.
What is the SMILES notation for [(E)-3-oxobut-1-enyl] carbamimidothioate?
The canonical SMILES for [(E)-3-oxobut-1-enyl] carbamimidothioate is [H]/N=C(\N)S/C=C/C(C)=O.
What is the InChIKey of [(E)-3-oxobut-1-enyl] carbamimidothioate?
The InChIKey is ZRMLNPOEKZQZQH-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H8N2OS/c1-4(8)2-3-9-5(6)7/h2-3H,1H3,(H3,6,7)/b3-2+.
What are the key properties of [(E)-3-oxobut-1-enyl] carbamimidothioate?
[(E)-3-oxobut-1-enyl] carbamimidothioate has a molecular weight of 144.20 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-oxobut-1-enyl] carbamimidothioate is sourced from PubChem (CID 12948459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).