About (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine
(6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine (PubChem CID 129484949) has the molecular formula C16H19F2N3O2
and a molecular weight of 323.34 g/mol. Its IUPAC name is (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine |
| PubChem CID | 129484949 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine |
| SMILES | COC[C@@H]1CN(c2cnc3cc(F)c(F)cc3n2)CC(C)(C)O1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-16(2)9-21(7-10(23-16)8-22-3)15-6-19-13-4-11(17)12(18)5-14(13)20-15/h4-6,10H,7-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | MLCADEYGQROODR-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine?
The IUPAC name of (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine (CID 129484949) is (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine.
What is the SMILES notation for (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine?
The canonical SMILES for (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine is COC[C@@H]1CN(c2cnc3cc(F)c(F)cc3n2)CC(C)(C)O1.
What is the InChIKey of (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine?
The InChIKey is MLCADEYGQROODR-JTQLQIEISA-N. The full InChI is InChI=1S/C16H19F2N3O2/c1-16(2)9-21(7-10(23-16)8-22-3)15-6-19-13-4-11(17)12(18)5-14(13)20-15/h4-6,10H,7-9H2,1-3H3/t10-/m0/s1.
What are the key properties of (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine?
(6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine has a molecular weight of 323.34 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-(6,7-difluoroquinoxalin-2-yl)-6-(methoxymethyl)-2,2-dimethylmorpholine is sourced from PubChem (CID 129484949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).