About 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile
2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile (PubChem CID 129485184) has the molecular formula C17H14F3N3O
and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile |
| PubChem CID | 129485184 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2C[C@@H](O)C[C@@H]2c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3N3O/c18-17(19,20)14-4-2-1-3-13(14)15-8-12(24)10-23(15)16-7-11(9-21)5-6-22-16/h1-7,12,15,24H,8,10H2/t12-,15+/m0/s1 |
| InChIKey | SJQSPEHOMFCHSK-SWLSCSKDSA-N |
| XLogP | 3.28 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile?
The IUPAC name of 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile (CID 129485184) is 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile is N#Cc1ccnc(N2C[C@@H](O)C[C@@H]2c2ccccc2C(F)(F)F)c1.
What is the InChIKey of 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile?
The InChIKey is SJQSPEHOMFCHSK-SWLSCSKDSA-N. The full InChI is InChI=1S/C17H14F3N3O/c18-17(19,20)14-4-2-1-3-13(14)15-8-12(24)10-23(15)16-7-11(9-21)5-6-22-16/h1-7,12,15,24H,8,10H2/t12-,15+/m0/s1.
What are the key properties of 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile?
2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile has a molecular weight of 333.31 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4S)-4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]pyridine-4-carbonitrile is sourced from PubChem (CID 129485184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).