C16H21N3O2S — CID 129486600
N-[5-cyano-2-(methylamino)phenyl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]acetamide (PubChem CID 129486600) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[5-cyano-2-(methylamino)phenyl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]acetamide.
| Compound Name | N-[5-cyano-2-(methylamino)phenyl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 129486600 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[5-cyano-2-(methylamino)phenyl]-2-[[(2S)-oxan-2-yl]methylsulfanyl]acetamide |
| SMILES | CNc1ccc(C#N)cc1NC(=O)CSC[C@@H]1CCCCO1 |
| InChI | InChI=1S/C16H21N3O2S/c1-18-14-6-5-12(9-17)8-15(14)19-16(20)11-22-10-13-4-2-3-7-21-13/h5-6,8,13,18H,2-4,7,10-11H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | YUBWHOMTYQNNMC-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |