C16H21N5O3 — CID 129487026
6-methoxy-N-[(R)-(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]pyridazine-3-carboxamide (PubChem CID 129487026) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 6-methoxy-N-[(R)-(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]pyridazine-3-carboxamide.
| Compound Name | 6-methoxy-N-[(R)-(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 129487026 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 6-methoxy-N-[(R)-(1-methylimidazol-2-yl)-(oxan-4-yl)methyl]pyridazine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N[C@@H](c2nccn2C)C2CCOCC2)nn1 |
| InChI | InChI=1S/C16H21N5O3/c1-21-8-7-17-15(21)14(11-5-9-24-10-6-11)18-16(22)12-3-4-13(23-2)20-19-12/h3-4,7-8,11,14H,5-6,9-10H2,1-2H3,(H,18,22)/t14-/m1/s1 |
| InChIKey | BDKHRXGAHDBUFA-CQSZACIVSA-N |
| XLogP | 1.12 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |