C11H12FN3 — CID 129487722
5-[(2S)-2-(fluoromethyl)pyrrolidin-1-yl]pyridine-2-carbonitrile (PubChem CID 129487722) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 5-[(2S)-2-(fluoromethyl)pyrrolidin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[(2S)-2-(fluoromethyl)pyrrolidin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 129487722 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 5-[(2S)-2-(fluoromethyl)pyrrolidin-1-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCC[C@H]2CF)cn1 |
| InChI | InChI=1S/C11H12FN3/c12-6-10-2-1-5-15(10)11-4-3-9(7-13)14-8-11/h3-4,8,10H,1-2,5-6H2/t10-/m0/s1 |
| InChIKey | BRYLTRSFCLATMZ-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |