About (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine
(3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine (PubChem CID 129488065) has the molecular formula C12H20FN3
and a molecular weight of 225.31 g/mol. Its IUPAC name is (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine.
Molecular Properties
| Compound Name | (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine |
| PubChem CID | 129488065 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine |
| SMILES | Cc1c(CN2CCC[C@](C)(F)C2)cnn1C |
| InChI | InChI=1S/C12H20FN3/c1-10-11(7-14-15(10)3)8-16-6-4-5-12(2,13)9-16/h7H,4-6,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | CZAUZZZQJNTZKM-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine?
The IUPAC name of (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine (CID 129488065) is (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine.
What is the SMILES notation for (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine?
The canonical SMILES for (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine is Cc1c(CN2CCC[C@](C)(F)C2)cnn1C.
What is the InChIKey of (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine?
The InChIKey is CZAUZZZQJNTZKM-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H20FN3/c1-10-11(7-14-15(10)3)8-16-6-4-5-12(2,13)9-16/h7H,4-6,8-9H2,1-3H3/t12-/m0/s1.
What are the key properties of (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine?
(3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine has a molecular weight of 225.31 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-3-methylpiperidine is sourced from PubChem (CID 129488065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).