About 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide
2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide (PubChem CID 129488212) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide |
| PubChem CID | 129488212 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(N[C@@H]1c2ccccc2CC12CCOCC2)c1cnc(C2CC2)nc1 |
| InChI | InChI=1S/C21H23N3O2/c25-20(16-12-22-19(23-13-16)14-5-6-14)24-18-17-4-2-1-3-15(17)11-21(18)7-9-26-10-8-21/h1-4,12-14,18H,5-11H2,(H,24,25)/t18-/m1/s1 |
| InChIKey | ZNMXYWCZRDXOMW-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide?
The IUPAC name of 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide (CID 129488212) is 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide is O=C(N[C@@H]1c2ccccc2CC12CCOCC2)c1cnc(C2CC2)nc1.
What is the InChIKey of 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide?
The InChIKey is ZNMXYWCZRDXOMW-GOSISDBHSA-N. The full InChI is InChI=1S/C21H23N3O2/c25-20(16-12-22-19(23-13-16)14-5-6-14)24-18-17-4-2-1-3-15(17)11-21(18)7-9-26-10-8-21/h1-4,12-14,18H,5-11H2,(H,24,25)/t18-/m1/s1.
What are the key properties of 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide?
2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide has a molecular weight of 349.43 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[(1S)-spiro[1,3-dihydroindene-2,4'-oxane]-1-yl]pyrimidine-5-carboxamide is sourced from PubChem (CID 129488212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).