C15H14N2O3 — CID 129489318
2-(2H-chromen-3-yl)-5-[(3S)-oxolan-3-yl]-1,3,4-oxadiazole (PubChem CID 129489318) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(2H-chromen-3-yl)-5-[(3S)-oxolan-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(2H-chromen-3-yl)-5-[(3S)-oxolan-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 129489318 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(2H-chromen-3-yl)-5-[(3S)-oxolan-3-yl]-1,3,4-oxadiazole |
| SMILES | C1=C(c2nnc([C@H]3CCOC3)o2)COc2ccccc21 |
| InChI | InChI=1S/C15H14N2O3/c1-2-4-13-10(3-1)7-12(9-19-13)15-17-16-14(20-15)11-5-6-18-8-11/h1-4,7,11H,5-6,8-9H2/t11-/m0/s1 |
| InChIKey | LFGYNFDGJNSSEJ-NSHDSACASA-N |
| XLogP | 2.51 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |