C15H26N2O2 — CID 129489862
(2R)-N-cyclopropyl-2-hydroxy-2-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide (PubChem CID 129489862) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-hydroxy-2-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide.
| Compound Name | (2R)-N-cyclopropyl-2-hydroxy-2-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 129489862 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (2R)-N-cyclopropyl-2-hydroxy-2-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
| SMILES | CC(C)=CCN1CCC([C@@H](O)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C15H26N2O2/c1-11(2)5-8-17-9-6-12(7-10-17)14(18)15(19)16-13-3-4-13/h5,12-14,18H,3-4,6-10H2,1-2H3,(H,16,19)/t14-/m1/s1 |
| InChIKey | FBHCEYGNPMUQAN-CQSZACIVSA-N |
| XLogP | 1.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|