C23H38N4O — CID 129490722
N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazol-4-yl]-N-methylpropanamide (PubChem CID 129490722) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazol-4-yl]-N-methylpropanamide.
| Compound Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazol-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 129490722 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[3,5-dimethyl-1-(2-methylprop-2-enyl)pyrazol-4-yl]-N-methylpropanamide |
| SMILES | C=C(C)Cn1nc(C)c(CCC(=O)N(C)C[C@H]2CCCN3CCCC[C@H]23)c1C |
| InChI | InChI=1S/C23H38N4O/c1-17(2)15-27-19(4)21(18(3)24-27)11-12-23(28)25(5)16-20-9-8-14-26-13-7-6-10-22(20)26/h20,22H,1,6-16H2,2-5H3/t20-,22-/m1/s1 |
| InChIKey | FCSPNRIJBMXIIB-IFMALSPDSA-N |
| XLogP | 3.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|