C11H21NO4 — CID 129492978
methyl (3R,4S)-4-hydroxy-1-(3-methoxypropyl)piperidine-3-carboxylate (PubChem CID 129492978) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl (3R,4S)-4-hydroxy-1-(3-methoxypropyl)piperidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-4-hydroxy-1-(3-methoxypropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 129492978 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | methyl (3R,4S)-4-hydroxy-1-(3-methoxypropyl)piperidine-3-carboxylate |
| SMILES | COCCCN1CC[C@H](O)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C11H21NO4/c1-15-7-3-5-12-6-4-10(13)9(8-12)11(14)16-2/h9-10,13H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | CGEVFJYLHUSOGF-ZJUUUORDSA-N |
| XLogP | -0.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|