About (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid
(3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid (PubChem CID 129493333) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid.
Analyze (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid (CID 129493333) is (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid is CC(C)(C)C(=O)CN1CC[C@@H](C(=O)O)C1.
What is the InChIKey of (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid?
The InChIKey is IIEKGLMNVIEVPY-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-11(2,3)9(13)7-12-5-4-8(6-12)10(14)15/h8H,4-7H2,1-3H3,(H,14,15)/t8-/m1/s1.
What are the key properties of (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid?
(3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(3,3-dimethyl-2-oxobutyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 129493333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).