C7H10ClF2NO — CID 129493863
(2R)-2-chloro-1-(3,3-difluoroazetidin-1-yl)butan-1-one (PubChem CID 129493863) has the molecular formula C7H10ClF2NO and a molecular weight of 197.61 g/mol. Its IUPAC name is (2R)-2-chloro-1-(3,3-difluoroazetidin-1-yl)butan-1-one.
| Compound Name | (2R)-2-chloro-1-(3,3-difluoroazetidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 129493863 |
| Molecular Formula | C7H10ClF2NO |
| Molecular Weight | 197.61 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | (2R)-2-chloro-1-(3,3-difluoroazetidin-1-yl)butan-1-one |
| SMILES | CC[C@@H](Cl)C(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C7H10ClF2NO/c1-2-5(8)6(12)11-3-7(9,10)4-11/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | QEFDLOATCVTIHJ-RXMQYKEDSA-N |
| XLogP | 1.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.61 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|