C9H18N2O — CID 129495551
(3R,4S)-1-amino-3-(cyclopropylmethyl)piperidin-4-ol (PubChem CID 129495551) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (3R,4S)-1-amino-3-(cyclopropylmethyl)piperidin-4-ol.
| Compound Name | (3R,4S)-1-amino-3-(cyclopropylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 129495551 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (3R,4S)-1-amino-3-(cyclopropylmethyl)piperidin-4-ol |
| SMILES | NN1CC[C@H](O)[C@H](CC2CC2)C1 |
| InChI | InChI=1S/C9H18N2O/c10-11-4-3-9(12)8(6-11)5-7-1-2-7/h7-9,12H,1-6,10H2/t8-,9+/m1/s1 |
| InChIKey | BUIHGYTZSXYZFV-BDAKNGLRSA-N |
| XLogP | 0.34 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|