About (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one
(2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one (PubChem CID 129495873) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one.
Molecular Properties
| Compound Name | (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one |
| PubChem CID | 129495873 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one |
| SMILES | C[C@H](N)C(=O)N1CCC[C@]2(C[C@@H](O)CCO2)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-9(13)11(16)14-5-2-4-12(8-14)7-10(15)3-6-17-12/h9-10,15H,2-8,13H2,1H3/t9-,10-,12-/m0/s1 |
| InChIKey | CJBNXXRMFLJKEK-NHCYSSNCSA-N |
| XLogP | -0.13 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one?
The IUPAC name of (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one (CID 129495873) is (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one.
What is the SMILES notation for (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one?
The canonical SMILES for (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one is C[C@H](N)C(=O)N1CCC[C@]2(C[C@@H](O)CCO2)C1.
What is the InChIKey of (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one?
The InChIKey is CJBNXXRMFLJKEK-NHCYSSNCSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-9(13)11(16)14-5-2-4-12(8-14)7-10(15)3-6-17-12/h9-10,15H,2-8,13H2,1H3/t9-,10-,12-/m0/s1.
What are the key properties of (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one?
(2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one has a molecular weight of 242.32 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-[(4S,6S)-4-hydroxy-1-oxa-8-azaspiro[5.5]undecan-8-yl]propan-1-one is sourced from PubChem (CID 129495873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).