C10H19N5 — CID 129496715
[1-[[(2R)-1-methylpiperidin-2-yl]methyl]triazol-4-yl]methanamine (PubChem CID 129496715) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is [1-[[(2R)-1-methylpiperidin-2-yl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[(2R)-1-methylpiperidin-2-yl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 129496715 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | [1-[[(2R)-1-methylpiperidin-2-yl]methyl]triazol-4-yl]methanamine |
| SMILES | CN1CCCC[C@@H]1Cn1cc(CN)nn1 |
| InChI | InChI=1S/C10H19N5/c1-14-5-3-2-4-10(14)8-15-7-9(6-11)12-13-15/h7,10H,2-6,8,11H2,1H3/t10-/m1/s1 |
| InChIKey | WCBXKXDUGHMFDS-SNVBAGLBSA-N |
| XLogP | 0.22 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |