C10H20N2O2 — CID 129496915
(4R,6R)-4-methoxy-1-oxa-8-azaspiro[5.5]undecan-8-amine (PubChem CID 129496915) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4R,6R)-4-methoxy-1-oxa-8-azaspiro[5.5]undecan-8-amine.
| Compound Name | (4R,6R)-4-methoxy-1-oxa-8-azaspiro[5.5]undecan-8-amine |
|---|---|
| PubChem CID | 129496915 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (4R,6R)-4-methoxy-1-oxa-8-azaspiro[5.5]undecan-8-amine |
| SMILES | CO[C@@H]1CCO[C@]2(CCCN(N)C2)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-13-9-3-6-14-10(7-9)4-2-5-12(11)8-10/h9H,2-8,11H2,1H3/t9-,10-/m1/s1 |
| InChIKey | FSLVUOJVFCIMLF-NXEZZACHSA-N |
| XLogP | 0.52 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|