About 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one
3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one (PubChem CID 129497156) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one |
| PubChem CID | 129497156 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one |
| SMILES | NCCC(=O)N1C[C@@H](O)[C@H](n2cccn2)C1 |
| InChI | InChI=1S/C10H16N4O2/c11-3-2-10(16)13-6-8(9(15)7-13)14-5-1-4-12-14/h1,4-5,8-9,15H,2-3,6-7,11H2/t8-,9-/m1/s1 |
| InChIKey | GBVAHKLSWWCZAK-RKDXNWHRSA-N |
| XLogP | -1.02 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one?
The IUPAC name of 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one (CID 129497156) is 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one.
What is the SMILES notation for 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one?
The canonical SMILES for 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one is NCCC(=O)N1C[C@@H](O)[C@H](n2cccn2)C1.
What is the InChIKey of 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one?
The InChIKey is GBVAHKLSWWCZAK-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H16N4O2/c11-3-2-10(16)13-6-8(9(15)7-13)14-5-1-4-12-14/h1,4-5,8-9,15H,2-3,6-7,11H2/t8-,9-/m1/s1.
What are the key properties of 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one?
3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one has a molecular weight of 224.26 g/mol, XLogP of -1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(3R,4R)-3-hydroxy-4-pyrazol-1-ylpyrrolidin-1-yl]propan-1-one is sourced from PubChem (CID 129497156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).