C11H15ClFN3O — CID 129497530
(3R,4S)-1-(3-chloropyrazin-2-yl)-3-(2-fluoroethyl)piperidin-4-ol (PubChem CID 129497530) has the molecular formula C11H15ClFN3O and a molecular weight of 259.71 g/mol. Its IUPAC name is (3R,4S)-1-(3-chloropyrazin-2-yl)-3-(2-fluoroethyl)piperidin-4-ol.
| Compound Name | (3R,4S)-1-(3-chloropyrazin-2-yl)-3-(2-fluoroethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 129497530 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (3R,4S)-1-(3-chloropyrazin-2-yl)-3-(2-fluoroethyl)piperidin-4-ol |
| SMILES | O[C@H]1CCN(c2nccnc2Cl)C[C@H]1CCF |
| InChI | InChI=1S/C11H15ClFN3O/c12-10-11(15-5-4-14-10)16-6-2-9(17)8(7-16)1-3-13/h4-5,8-9,17H,1-3,6-7H2/t8-,9+/m1/s1 |
| InChIKey | GYGRCSSJBWYZTN-BDAKNGLRSA-N |
| XLogP | 1.68 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |